C24H25N5O4S — CID 24732456
N-(furan-2-ylmethyl)-N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]quinoline-8-sulfonamide (PubChem CID 24732456) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]quinoline-8-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 24732456 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]quinoline-8-sulfonamide |
| SMILES | COc1ccnc(N2CCC(N(Cc3ccco3)S(=O)(=O)c3cccc4cccnc34)CC2)n1 |
| InChI | InChI=1S/C24H25N5O4S/c1-32-22-9-13-26-24(27-22)28-14-10-19(11-15-28)29(17-20-7-4-16-33-20)34(30,31)21-8-2-5-18-6-3-12-25-23(18)21/h2-9,12-13,16,19H,10-11,14-15,17H2,1H3 |
| InChIKey | NQTKBFLUYYAVST-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |