C19H27N5O3 — CID 24732298
1-(furan-2-ylmethyl)-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-3-propan-2-ylurea (PubChem CID 24732298) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-3-propan-2-ylurea.
| Compound Name | 1-(furan-2-ylmethyl)-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 24732298 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-3-propan-2-ylurea |
| SMILES | COc1ccnc(N2CCC(N(Cc3ccco3)C(=O)NC(C)C)CC2)n1 |
| InChI | InChI=1S/C19H27N5O3/c1-14(2)21-19(25)24(13-16-5-4-12-27-16)15-7-10-23(11-8-15)18-20-9-6-17(22-18)26-3/h4-6,9,12,14-15H,7-8,10-11,13H2,1-3H3,(H,21,25) |
| InChIKey | LNPJISBJCJERGS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |