C15H23N5O3 — CID 31895955
N-(2-acetamidoethyl)-1-(4-methoxypyrimidin-2-yl)piperidine-4-carboxamide (PubChem CID 31895955) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-1-(4-methoxypyrimidin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-1-(4-methoxypyrimidin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31895955 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-(2-acetamidoethyl)-1-(4-methoxypyrimidin-2-yl)piperidine-4-carboxamide |
| SMILES | COc1ccnc(N2CCC(C(=O)NCCNC(C)=O)CC2)n1 |
| InChI | InChI=1S/C15H23N5O3/c1-11(21)16-7-8-17-14(22)12-4-9-20(10-5-12)15-18-6-3-13(19-15)23-2/h3,6,12H,4-5,7-10H2,1-2H3,(H,16,21)(H,17,22) |
| InChIKey | LUSARCITAQNTIM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|