C15H21FN4O2 — CID 165432135
N-[[4-fluoro-1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]cyclopropanecarboxamide (PubChem CID 165432135) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[[4-fluoro-1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[4-fluoro-1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 165432135 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[[4-fluoro-1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]methyl]cyclopropanecarboxamide |
| SMILES | COc1ccnc(N2CCC(F)(CNC(=O)C3CC3)CC2)n1 |
| InChI | InChI=1S/C15H21FN4O2/c1-22-12-4-7-17-14(19-12)20-8-5-15(16,6-9-20)10-18-13(21)11-2-3-11/h4,7,11H,2-3,5-6,8-10H2,1H3,(H,18,21) |
| InChIKey | PRGXXLCACQEVFK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |