C15H14N6O2 — CID 75505978
6-N,6-N-bis(furan-2-ylmethyl)-7H-purine-2,6-diamine (PubChem CID 75505978) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 6-N,6-N-bis(furan-2-ylmethyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N,6-N-bis(furan-2-ylmethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 75505978 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-N,6-N-bis(furan-2-ylmethyl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(N(Cc2ccco2)Cc2ccco2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H14N6O2/c16-15-19-13-12(17-9-18-13)14(20-15)21(7-10-3-1-5-22-10)8-11-4-2-6-23-11/h1-6,9H,7-8H2,(H3,16,17,18,19,20) |
| InChIKey | FHUFIPFOIHZEMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |