C11H18N6O — CID 104623697
1-[(2-amino-7H-purin-6-yl)-ethylamino]-2-methylpropan-2-ol (PubChem CID 104623697) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-[(2-amino-7H-purin-6-yl)-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2-amino-7H-purin-6-yl)-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 104623697 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(2-amino-7H-purin-6-yl)-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H18N6O/c1-4-17(5-11(2,3)18)9-7-8(14-6-13-7)15-10(12)16-9/h6,18H,4-5H2,1-3H3,(H3,12,13,14,15,16) |
| InChIKey | VGDNCLIGZWHTSQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |