C10H14ClN5O — CID 104697884
1-[(2-chloro-7H-purin-6-yl)-methylamino]-2-methylpropan-2-ol (PubChem CID 104697884) has the molecular formula C10H14ClN5O and a molecular weight of 255.71 g/mol. Its IUPAC name is 1-[(2-chloro-7H-purin-6-yl)-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2-chloro-7H-purin-6-yl)-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 104697884 |
| Molecular Formula | C10H14ClN5O |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-[(2-chloro-7H-purin-6-yl)-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CC(C)(C)O)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H14ClN5O/c1-10(2,17)4-16(3)8-6-7(13-5-12-6)14-9(11)15-8/h5,17H,4H2,1-3H3,(H,12,13,14,15) |
| InChIKey | RDRFMCDCBPUFSA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |