C9H12ClN5O2S — CID 104787415
2-chloro-N-methyl-N-(2-methylsulfonylethyl)-7H-purin-6-amine (PubChem CID 104787415) has the molecular formula C9H12ClN5O2S and a molecular weight of 289.75 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(2-methylsulfonylethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-methyl-N-(2-methylsulfonylethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 104787415 |
| Molecular Formula | C9H12ClN5O2S |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-chloro-N-methyl-N-(2-methylsulfonylethyl)-7H-purin-6-amine |
| SMILES | CN(CCS(C)(=O)=O)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12ClN5O2S/c1-15(3-4-18(2,16)17)8-6-7(12-5-11-6)13-9(10)14-8/h5H,3-4H2,1-2H3,(H,11,12,13,14) |
| InChIKey | BFCPWGZRLBCVPX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |