C12H11ClN6 — CID 113453067
2-chloro-N-methyl-N-(pyridin-2-ylmethyl)-7H-purin-6-amine (PubChem CID 113453067) has the molecular formula C12H11ClN6 and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(pyridin-2-ylmethyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-methyl-N-(pyridin-2-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 113453067 |
| Molecular Formula | C12H11ClN6 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-chloro-N-methyl-N-(pyridin-2-ylmethyl)-7H-purin-6-amine |
| SMILES | CN(Cc1ccccn1)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H11ClN6/c1-19(6-8-4-2-3-5-14-8)11-9-10(16-7-15-9)17-12(13)18-11/h2-5,7H,6H2,1H3,(H,15,16,17,18) |
| InChIKey | DQOBRXFZECXLNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |