C13H9ClN6 — CID 104697441
2-[(2-chloro-7H-purin-6-yl)-methylamino]benzonitrile (PubChem CID 104697441) has the molecular formula C13H9ClN6 and a molecular weight of 284.71 g/mol. Its IUPAC name is 2-[(2-chloro-7H-purin-6-yl)-methylamino]benzonitrile.
| Compound Name | 2-[(2-chloro-7H-purin-6-yl)-methylamino]benzonitrile |
|---|---|
| PubChem CID | 104697441 |
| Molecular Formula | C13H9ClN6 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[(2-chloro-7H-purin-6-yl)-methylamino]benzonitrile |
| SMILES | CN(c1ccccc1C#N)c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H9ClN6/c1-20(9-5-3-2-4-8(9)6-15)12-10-11(17-7-16-10)18-13(14)19-12/h2-5,7H,1H3,(H,16,17,18,19) |
| InChIKey | QTUSNWMCMSVYKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |