C13H6ClN7 — CID 107792395
4-[(2-chloro-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107792395) has the molecular formula C13H6ClN7 and a molecular weight of 295.69 g/mol. Its IUPAC name is 4-[(2-chloro-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2-chloro-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107792395 |
| Molecular Formula | C13H6ClN7 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 4-[(2-chloro-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2nc(Cl)nc3nc[nH]c23)cc1C#N |
| InChI | InChI=1S/C13H6ClN7/c14-13-20-11-10(17-6-18-11)12(21-13)19-9-2-1-7(4-15)8(3-9)5-16/h1-3,6H,(H2,17,18,19,20,21) |
| InChIKey | GBCPDBPQQAFIAA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |