C13H8N8 — CID 107795021
4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107795021) has the molecular formula C13H8N8 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107795021 |
| Molecular Formula | C13H8N8 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2nc(N)nc3nc[nH]c23)cc1C#N |
| InChI | InChI=1S/C13H8N8/c14-4-7-1-2-9(3-8(7)5-15)19-12-10-11(18-6-17-10)20-13(16)21-12/h1-3,6H,(H4,16,17,18,19,20,21) |
| InChIKey | SEYUZCRSEJXLNV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |