About 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile
4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107795021) has the molecular formula C13H8N8
and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
| PubChem CID | 107795021 |
| Molecular Formula | C13H8N8 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2nc(N)nc3nc[nH]c23)cc1C#N |
| InChI | InChI=1S/C13H8N8/c14-4-7-1-2-9(3-8(7)5-15)19-12-10-11(18-6-17-10)20-13(16)21-12/h1-3,6H,(H4,16,17,18,19,20,21) |
| InChIKey | SEYUZCRSEJXLNV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile?
The IUPAC name of 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile (CID 107795021) is 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile is N#Cc1ccc(Nc2nc(N)nc3nc[nH]c23)cc1C#N.
What is the InChIKey of 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile?
The InChIKey is SEYUZCRSEJXLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N8/c14-4-7-1-2-9(3-8(7)5-15)19-12-10-11(18-6-17-10)20-13(16)21-12/h1-3,6H,(H4,16,17,18,19,20,21).
What are the key properties of 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile?
4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile has a molecular weight of 276.26 g/mol, XLogP of 1.42, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-7H-purin-6-yl)amino]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 107795021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).