C12H11FN6O — CID 114841178
6-N-(4-fluoro-3-methoxyphenyl)-7H-purine-2,6-diamine (PubChem CID 114841178) has the molecular formula C12H11FN6O and a molecular weight of 274.26 g/mol. Its IUPAC name is 6-N-(4-fluoro-3-methoxyphenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(4-fluoro-3-methoxyphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114841178 |
| Molecular Formula | C12H11FN6O |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-N-(4-fluoro-3-methoxyphenyl)-7H-purine-2,6-diamine |
| SMILES | COc1cc(Nc2nc(N)nc3nc[nH]c23)ccc1F |
| InChI | InChI=1S/C12H11FN6O/c1-20-8-4-6(2-3-7(8)13)17-11-9-10(16-5-15-9)18-12(14)19-11/h2-5H,1H3,(H4,14,15,16,17,18,19) |
| InChIKey | IODDKELBIWDQRL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |