C10H11FN6O — CID 91334398
2-N-(4-fluoro-3-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 91334398) has the molecular formula C10H11FN6O and a molecular weight of 250.24 g/mol. Its IUPAC name is 2-N-(4-fluoro-3-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-fluoro-3-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 91334398 |
| Molecular Formula | C10H11FN6O |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-N-(4-fluoro-3-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cc(Nc2nc(N)nc(N)n2)ccc1F |
| InChI | InChI=1S/C10H11FN6O/c1-18-7-4-5(2-3-6(7)11)14-10-16-8(12)15-9(13)17-10/h2-4H,1H3,(H5,12,13,14,15,16,17) |
| InChIKey | FWIVFWPALRWPPV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |