C11H11F2N5O — CID 80762744
2-N-(3,4-difluorophenyl)-6-ethoxy-1,3,5-triazine-2,4-diamine (PubChem CID 80762744) has the molecular formula C11H11F2N5O and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-N-(3,4-difluorophenyl)-6-ethoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3,4-difluorophenyl)-6-ethoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80762744 |
| Molecular Formula | C11H11F2N5O |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-N-(3,4-difluorophenyl)-6-ethoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H11F2N5O/c1-2-19-11-17-9(14)16-10(18-11)15-6-3-4-7(12)8(13)5-6/h3-5H,2H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | UNOTVTAUNYXOIC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |