C11H10F3N5O — CID 80855808
6-ethoxy-2-N-(2,4,6-trifluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80855808) has the molecular formula C11H10F3N5O and a molecular weight of 285.23 g/mol. Its IUPAC name is 6-ethoxy-2-N-(2,4,6-trifluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(2,4,6-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80855808 |
| Molecular Formula | C11H10F3N5O |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 6-ethoxy-2-N-(2,4,6-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(Nc2c(F)cc(F)cc2F)n1 |
| InChI | InChI=1S/C11H10F3N5O/c1-2-20-11-18-9(15)17-10(19-11)16-8-6(13)3-5(12)4-7(8)14/h3-4H,2H2,1H3,(H3,15,16,17,18,19) |
| InChIKey | QEWBYOFZAWNLSN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |