C11H14FN7O — CID 139976084
N-(4-fluoro-3-methoxyphenyl)-4,6-dihydrazinylpyrimidin-2-amine (PubChem CID 139976084) has the molecular formula C11H14FN7O and a molecular weight of 279.28 g/mol. Its IUPAC name is N-(4-fluoro-3-methoxyphenyl)-4,6-dihydrazinylpyrimidin-2-amine.
| Compound Name | N-(4-fluoro-3-methoxyphenyl)-4,6-dihydrazinylpyrimidin-2-amine |
|---|---|
| PubChem CID | 139976084 |
| Molecular Formula | C11H14FN7O |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(4-fluoro-3-methoxyphenyl)-4,6-dihydrazinylpyrimidin-2-amine |
| SMILES | COc1cc(Nc2nc(NN)cc(NN)n2)ccc1F |
| InChI | InChI=1S/C11H14FN7O/c1-20-8-4-6(2-3-7(8)12)15-11-16-9(18-13)5-10(17-11)19-14/h2-5H,13-14H2,1H3,(H3,15,16,17,18,19) |
| InChIKey | IRCVKNBJHVCQOM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|