C11H13FN6O — CID 114841204
4-N-(4-fluoro-3-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 114841204) has the molecular formula C11H13FN6O and a molecular weight of 264.26 g/mol. Its IUPAC name is 4-N-(4-fluoro-3-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-fluoro-3-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114841204 |
| Molecular Formula | C11H13FN6O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-N-(4-fluoro-3-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2cc(NN)nc(N)n2)ccc1F |
| InChI | InChI=1S/C11H13FN6O/c1-19-8-4-6(2-3-7(8)12)15-9-5-10(18-14)17-11(13)16-9/h2-5H,14H2,1H3,(H4,13,15,16,17,18) |
| InChIKey | SQYGNPPNPWTUBL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|