C12H12FN3O — CID 114837203
2-N-(4-fluoro-3-methoxyphenyl)pyridine-2,5-diamine (PubChem CID 114837203) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-N-(4-fluoro-3-methoxyphenyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(4-fluoro-3-methoxyphenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114837203 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-N-(4-fluoro-3-methoxyphenyl)pyridine-2,5-diamine |
| SMILES | COc1cc(Nc2ccc(N)cn2)ccc1F |
| InChI | InChI=1S/C12H12FN3O/c1-17-11-6-9(3-4-10(11)13)16-12-5-2-8(14)7-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | FBLLZHIKEHRPBV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_no_alk_A(1)', 'substructure': 'N/A'} |
|---|