C13H13ClN2O2 — CID 66218090
5-chloro-N-(3,4-dimethoxyphenyl)pyridin-2-amine (PubChem CID 66218090) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 5-chloro-N-(3,4-dimethoxyphenyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(3,4-dimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66218090 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-chloro-N-(3,4-dimethoxyphenyl)pyridin-2-amine |
| SMILES | COc1ccc(Nc2ccc(Cl)cn2)cc1OC |
| InChI | InChI=1S/C13H13ClN2O2/c1-17-11-5-4-10(7-12(11)18-2)16-13-6-3-9(14)8-15-13/h3-8H,1-2H3,(H,15,16) |
| InChIKey | WBFGTWOCBWQWKK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |