C13H11F3N2O — CID 114837137
2,6-difluoro-1-N-(4-fluoro-3-methoxyphenyl)benzene-1,4-diamine (PubChem CID 114837137) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is 2,6-difluoro-1-N-(4-fluoro-3-methoxyphenyl)benzene-1,4-diamine.
| Compound Name | 2,6-difluoro-1-N-(4-fluoro-3-methoxyphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114837137 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2,6-difluoro-1-N-(4-fluoro-3-methoxyphenyl)benzene-1,4-diamine |
| SMILES | COc1cc(Nc2c(F)cc(N)cc2F)ccc1F |
| InChI | InChI=1S/C13H11F3N2O/c1-19-12-6-8(2-3-9(12)14)18-13-10(15)4-7(17)5-11(13)16/h2-6,18H,17H2,1H3 |
| InChIKey | KRFZYPZHGHPJKH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|