C9H13FN2O — CID 114839038
N'-(4-fluoro-3-methoxyphenyl)ethane-1,2-diamine (PubChem CID 114839038) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is N'-(4-fluoro-3-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(4-fluoro-3-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114839038 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N'-(4-fluoro-3-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCN)ccc1F |
| InChI | InChI=1S/C9H13FN2O/c1-13-9-6-7(12-5-4-11)2-3-8(9)10/h2-3,6,12H,4-5,11H2,1H3 |
| InChIKey | JZLYRUZDAZDYQN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |