C11H13BrN6O — CID 80924462
4-N-(3-bromo-4-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80924462) has the molecular formula C11H13BrN6O and a molecular weight of 325.17 g/mol. Its IUPAC name is 4-N-(3-bromo-4-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-bromo-4-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80924462 |
| Molecular Formula | C11H13BrN6O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-N-(3-bromo-4-methoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2cc(NN)nc(N)n2)cc1Br |
| InChI | InChI=1S/C11H13BrN6O/c1-19-8-3-2-6(4-7(8)12)15-9-5-10(18-14)17-11(13)16-9/h2-5H,14H2,1H3,(H4,13,15,16,17,18) |
| InChIKey | KNOXSMDAOHXCKL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|