C13H11BrN4OS — CID 103328583
4-N-(3-bromo-4-methoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103328583) has the molecular formula C13H11BrN4OS and a molecular weight of 351.23 g/mol. Its IUPAC name is 4-N-(3-bromo-4-methoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-bromo-4-methoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103328583 |
| Molecular Formula | C13H11BrN4OS |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-N-(3-bromo-4-methoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(N)nc3sccc23)cc1Br |
| InChI | InChI=1S/C13H11BrN4OS/c1-19-10-3-2-7(6-9(10)14)16-11-8-4-5-20-12(8)18-13(15)17-11/h2-6H,1H3,(H3,15,16,17,18) |
| InChIKey | OMBGXCWKDJZNCI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |