C14H14N4O2S — CID 103323394
4-N-(3,5-dimethoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103323394) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-N-(3,5-dimethoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3,5-dimethoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103323394 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-N-(3,5-dimethoxyphenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2nc(N)nc3sccc23)cc(OC)c1 |
| InChI | InChI=1S/C14H14N4O2S/c1-19-9-5-8(6-10(7-9)20-2)16-12-11-3-4-21-13(11)18-14(15)17-12/h3-7H,1-2H3,(H3,15,16,17,18) |
| InChIKey | BVDURWVUASDYOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |