C12H9FN4S — CID 103323570
4-N-(3-fluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103323570) has the molecular formula C12H9FN4S and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-N-(3-fluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-fluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103323570 |
| Molecular Formula | C12H9FN4S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-N-(3-fluorophenyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(F)c2)c2ccsc2n1 |
| InChI | InChI=1S/C12H9FN4S/c13-7-2-1-3-8(6-7)15-10-9-4-5-18-11(9)17-12(14)16-10/h1-6H,(H3,14,15,16,17) |
| InChIKey | IRPZGASZDOGPPF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |