C12H7Cl2N3S — CID 82066220
2-chloro-N-(3-chlorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 82066220) has the molecular formula C12H7Cl2N3S and a molecular weight of 296.18 g/mol. Its IUPAC name is 2-chloro-N-(3-chlorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3-chlorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82066220 |
| Molecular Formula | C12H7Cl2N3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 2-chloro-N-(3-chlorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cccc(Nc2nc(Cl)nc3sccc23)c1 |
| InChI | InChI=1S/C12H7Cl2N3S/c13-7-2-1-3-8(6-7)15-10-9-4-5-18-11(9)17-12(14)16-10/h1-6H,(H,15,16,17) |
| InChIKey | HZVWNHNSYJCXHR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |