C12H5Cl3FN3S — CID 107576856
2-chloro-N-(3,5-dichloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 107576856) has the molecular formula C12H5Cl3FN3S and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107576856 |
| Molecular Formula | C12H5Cl3FN3S |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1c(Cl)cc(Nc2nc(Cl)nc3sccc23)cc1Cl |
| InChI | InChI=1S/C12H5Cl3FN3S/c13-7-3-5(4-8(14)9(7)16)17-10-6-1-2-20-11(6)19-12(15)18-10/h1-4H,(H,17,18,19) |
| InChIKey | UPVNNCPXGDXUSN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|