C14H7Cl3FN3 — CID 107576871
2-chloro-N-(3,5-dichloro-4-fluorophenyl)quinazolin-4-amine (PubChem CID 107576871) has the molecular formula C14H7Cl3FN3 and a molecular weight of 342.59 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-fluorophenyl)quinazolin-4-amine.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 107576871 |
| Molecular Formula | C14H7Cl3FN3 |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)quinazolin-4-amine |
| SMILES | Fc1c(Cl)cc(Nc2nc(Cl)nc3ccccc23)cc1Cl |
| InChI | InChI=1S/C14H7Cl3FN3/c15-9-5-7(6-10(16)12(9)18)19-13-8-3-1-2-4-11(8)20-14(17)21-13/h1-6H,(H,19,20,21) |
| InChIKey | UIIKNDNPURWYRP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|