C14H8ClF2N3 — CID 62477687
2-chloro-N-(3,5-difluorophenyl)quinazolin-4-amine (PubChem CID 62477687) has the molecular formula C14H8ClF2N3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 2-chloro-N-(3,5-difluorophenyl)quinazolin-4-amine.
| Compound Name | 2-chloro-N-(3,5-difluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 62477687 |
| Molecular Formula | C14H8ClF2N3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-chloro-N-(3,5-difluorophenyl)quinazolin-4-amine |
| SMILES | Fc1cc(F)cc(Nc2nc(Cl)nc3ccccc23)c1 |
| InChI | InChI=1S/C14H8ClF2N3/c15-14-19-12-4-2-1-3-11(12)13(20-14)18-10-6-8(16)5-9(17)7-10/h1-7H,(H,18,19,20) |
| InChIKey | JWNPUFVHXJOWDT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |