C20H12F4N4 — CID 177346625
2-N,3-N-bis(3,5-difluorophenyl)quinoxaline-2,3-diamine (PubChem CID 177346625) has the molecular formula C20H12F4N4 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-N,3-N-bis(3,5-difluorophenyl)quinoxaline-2,3-diamine.
| Compound Name | 2-N,3-N-bis(3,5-difluorophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 177346625 |
| Molecular Formula | C20H12F4N4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-N,3-N-bis(3,5-difluorophenyl)quinoxaline-2,3-diamine |
| SMILES | Fc1cc(F)cc(Nc2nc3ccccc3nc2Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C20H12F4N4/c21-11-5-12(22)8-15(7-11)25-19-20(26-16-9-13(23)6-14(24)10-16)28-18-4-2-1-3-17(18)27-19/h1-10H,(H,25,27)(H,26,28) |
| InChIKey | XMNTVWCZBHSMST-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |