C12H7F2N3 — CID 24703722
2-(3,5-difluoroanilino)pyridine-3-carbonitrile (PubChem CID 24703722) has the molecular formula C12H7F2N3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-(3,5-difluoroanilino)pyridine-3-carbonitrile.
| Compound Name | 2-(3,5-difluoroanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 24703722 |
| Molecular Formula | C12H7F2N3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(3,5-difluoroanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H7F2N3/c13-9-4-10(14)6-11(5-9)17-12-8(7-15)2-1-3-16-12/h1-6H,(H,16,17) |
| InChIKey | KKQNVJUVRHATNP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |