C12H6BrF2N3 — CID 43347821
2-(2-bromo-4,6-difluoroanilino)pyridine-3-carbonitrile (PubChem CID 43347821) has the molecular formula C12H6BrF2N3 and a molecular weight of 310.10 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluoroanilino)pyridine-3-carbonitrile.
| Compound Name | 2-(2-bromo-4,6-difluoroanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 43347821 |
| Molecular Formula | C12H6BrF2N3 |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 2-(2-bromo-4,6-difluoroanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H6BrF2N3/c13-9-4-8(14)5-10(15)11(9)18-12-7(6-16)2-1-3-17-12/h1-5H,(H,17,18) |
| InChIKey | NDORBYXTRAKNTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |