C12H7Br2N3 — CID 107600351
2-(2,6-dibromoanilino)pyridine-3-carbonitrile (PubChem CID 107600351) has the molecular formula C12H7Br2N3 and a molecular weight of 353.02 g/mol. Its IUPAC name is 2-(2,6-dibromoanilino)pyridine-3-carbonitrile.
| Compound Name | 2-(2,6-dibromoanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107600351 |
| Molecular Formula | C12H7Br2N3 |
| Molecular Weight | 353.02 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 2-(2,6-dibromoanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H7Br2N3/c13-9-4-1-5-10(14)11(9)17-12-8(7-15)3-2-6-16-12/h1-6H,(H,16,17) |
| InChIKey | GVHMAGUKVYKHGZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |