C13H9F2N3 — CID 15604437
N-(3,5-difluorophenyl)-1H-benzimidazol-2-amine (PubChem CID 15604437) has the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1H-benzimidazol-2-amine.
| Compound Name | N-(3,5-difluorophenyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 15604437 |
| Molecular Formula | C13H9F2N3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(3,5-difluorophenyl)-1H-benzimidazol-2-amine |
| SMILES | Fc1cc(F)cc(Nc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C13H9F2N3/c14-8-5-9(15)7-10(6-8)16-13-17-11-3-1-2-4-12(11)18-13/h1-7H,(H2,16,17,18) |
| InChIKey | VDELLUVTWLBIHA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |