C13H8F2N2S — CID 177375670
2-(3,5-difluorophenyl)sulfanyl-1H-benzimidazole (PubChem CID 177375670) has the molecular formula C13H8F2N2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)sulfanyl-1H-benzimidazole.
| Compound Name | 2-(3,5-difluorophenyl)sulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 177375670 |
| Molecular Formula | C13H8F2N2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-(3,5-difluorophenyl)sulfanyl-1H-benzimidazole |
| SMILES | Fc1cc(F)cc(Sc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C13H8F2N2S/c14-8-5-9(15)7-10(6-8)18-13-16-11-3-1-2-4-12(11)17-13/h1-7H,(H,16,17) |
| InChIKey | MPUPRBIFAIMXHH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |