C12H6Cl3N3S — CID 102752249
2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-benzimidazole (PubChem CID 102752249) has the molecular formula C12H6Cl3N3S and a molecular weight of 330.63 g/mol. Its IUPAC name is 2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-benzimidazole.
| Compound Name | 2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 102752249 |
| Molecular Formula | C12H6Cl3N3S |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | 2-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-benzimidazole |
| SMILES | Clc1cc(Cl)c(Sc2nc3ccccc3[nH]2)nc1Cl |
| InChI | InChI=1S/C12H6Cl3N3S/c13-6-5-7(14)11(18-10(6)15)19-12-16-8-3-1-2-4-9(8)17-12/h1-5H,(H,16,17) |
| InChIKey | KWDSOKDMRFSNDH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|