About 1H-benzimidazol-2-yl thiohypoiodite
1H-benzimidazol-2-yl thiohypoiodite (PubChem CID 142014861) has the molecular formula C7H5IN2S
and a molecular weight of 276.10 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl thiohypoiodite.
Molecular Properties
| Compound Name | 1H-benzimidazol-2-yl thiohypoiodite |
| PubChem CID | 142014861 |
| Molecular Formula | C7H5IN2S |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.92 |
| IUPAC Name | 1H-benzimidazol-2-yl thiohypoiodite |
| SMILES | ISc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5IN2S/c8-11-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10) |
| InChIKey | GHFMDQCBZWYLOC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-2-yl thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-2-yl thiohypoiodite?
The IUPAC name of 1H-benzimidazol-2-yl thiohypoiodite (CID 142014861) is 1H-benzimidazol-2-yl thiohypoiodite.
What is the SMILES notation for 1H-benzimidazol-2-yl thiohypoiodite?
The canonical SMILES for 1H-benzimidazol-2-yl thiohypoiodite is ISc1nc2ccccc2[nH]1.
What is the InChIKey of 1H-benzimidazol-2-yl thiohypoiodite?
The InChIKey is GHFMDQCBZWYLOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2S/c8-11-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10).
What are the key properties of 1H-benzimidazol-2-yl thiohypoiodite?
1H-benzimidazol-2-yl thiohypoiodite has a molecular weight of 276.10 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-2-yl thiohypoiodite is sourced from PubChem (CID 142014861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).