C11H9ClN6S — CID 80930355
[4-(1H-benzimidazol-2-ylsulfanyl)-5-chloropyrimidin-2-yl]hydrazine (PubChem CID 80930355) has the molecular formula C11H9ClN6S and a molecular weight of 292.76 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-ylsulfanyl)-5-chloropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1H-benzimidazol-2-ylsulfanyl)-5-chloropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930355 |
| Molecular Formula | C11H9ClN6S |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | [4-(1H-benzimidazol-2-ylsulfanyl)-5-chloropyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(Cl)c(Sc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C11H9ClN6S/c12-6-5-14-10(18-13)17-9(6)19-11-15-7-3-1-2-4-8(7)16-11/h1-5H,13H2,(H,15,16)(H,14,17,18) |
| InChIKey | FYKCADZTTKILDH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|