C11H8FN5S — CID 80882219
4-(1H-benzimidazol-2-ylsulfanyl)-5-fluoropyrimidin-2-amine (PubChem CID 80882219) has the molecular formula C11H8FN5S and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80882219 |
| Molecular Formula | C11H8FN5S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Sc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C11H8FN5S/c12-6-5-14-10(13)17-9(6)18-11-15-7-3-1-2-4-8(7)16-11/h1-5H,(H,15,16)(H2,13,14,17) |
| InChIKey | LIDZJGMMLLQOJH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |