C14H12FN3S — CID 43657640
[4-(1H-benzimidazol-2-ylsulfanyl)-3-fluorophenyl]methanamine (PubChem CID 43657640) has the molecular formula C14H12FN3S and a molecular weight of 273.34 g/mol. Its IUPAC name is [4-(1H-benzimidazol-2-ylsulfanyl)-3-fluorophenyl]methanamine.
| Compound Name | [4-(1H-benzimidazol-2-ylsulfanyl)-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 43657640 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | [4-(1H-benzimidazol-2-ylsulfanyl)-3-fluorophenyl]methanamine |
| SMILES | NCc1ccc(Sc2nc3ccccc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C14H12FN3S/c15-10-7-9(8-16)5-6-13(10)19-14-17-11-3-1-2-4-12(11)18-14/h1-7H,8,16H2,(H,17,18) |
| InChIKey | FIITYQFYHSDHPC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |