C15H14ClN3OS — CID 63087024
[3-chloro-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine (PubChem CID 63087024) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is [3-chloro-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine.
| Compound Name | [3-chloro-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine |
|---|---|
| PubChem CID | 63087024 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | [3-chloro-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine |
| SMILES | COc1ccc2nc(Sc3ccc(CN)cc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C15H14ClN3OS/c1-20-10-3-4-12-13(7-10)19-15(18-12)21-14-5-2-9(8-17)6-11(14)16/h2-7H,8,17H2,1H3,(H,18,19) |
| InChIKey | ZTGVYFFVHFWAIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |