C15H10BrN3OS — CID 114893409
5-bromo-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]benzonitrile (PubChem CID 114893409) has the molecular formula C15H10BrN3OS and a molecular weight of 360.24 g/mol. Its IUPAC name is 5-bromo-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 5-bromo-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 114893409 |
| Molecular Formula | C15H10BrN3OS |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 5-bromo-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]benzonitrile |
| SMILES | COc1ccc2nc(Sc3ccc(Br)cc3C#N)[nH]c2c1 |
| InChI | InChI=1S/C15H10BrN3OS/c1-20-11-3-4-12-13(7-11)19-15(18-12)21-14-5-2-10(16)6-9(14)8-17/h2-7H,1H3,(H,18,19) |
| InChIKey | DDKLYWRFTXUQMH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |