C13H10FN3OS — CID 61228416
2-[(6-fluoro-2-pyridinyl)sulfanyl]-6-methoxy-1H-benzimidazole (PubChem CID 61228416) has the molecular formula C13H10FN3OS and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(6-fluoro-2-pyridinyl)sulfanyl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[(6-fluoro-2-pyridinyl)sulfanyl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 61228416 |
| Molecular Formula | C13H10FN3OS |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(6-fluoro-2-pyridinyl)sulfanyl]-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(Sc3cccc(F)n3)[nH]c2c1 |
| InChI | InChI=1S/C13H10FN3OS/c1-18-8-5-6-9-10(7-8)16-13(15-9)19-12-4-2-3-11(14)17-12/h2-7H,1H3,(H,15,16) |
| InChIKey | ZEEPMDQDOJMDAG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|