C14H13N3O2S — CID 80651608
[6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-3-pyridinyl]methanol (PubChem CID 80651608) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is [6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-3-pyridinyl]methanol.
| Compound Name | [6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 80651608 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-3-pyridinyl]methanol |
| SMILES | COc1ccc2nc(Sc3ccc(CO)cn3)[nH]c2c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-19-10-3-4-11-12(6-10)17-14(16-11)20-13-5-2-9(8-18)7-15-13/h2-7,18H,8H2,1H3,(H,16,17) |
| InChIKey | RNGIDPKYEQBLRJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |