C11H14N2OS — CID 2650025
6-methoxy-2-propylsulfanyl-1H-benzimidazole (PubChem CID 2650025) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-methoxy-2-propylsulfanyl-1H-benzimidazole.
| Compound Name | 6-methoxy-2-propylsulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 2650025 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 6-methoxy-2-propylsulfanyl-1H-benzimidazole |
| SMILES | CCCSc1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-6-15-11-12-9-5-4-8(14-2)7-10(9)13-11/h4-5,7H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | TYVFYXGXKSBOIK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |