C11H13ClN2O2S — CID 44889304
1-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]propan-2-one;hydrochloride (PubChem CID 44889304) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 1-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]propan-2-one;hydrochloride.
| Compound Name | 1-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]propan-2-one;hydrochloride |
|---|---|
| PubChem CID | 44889304 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]propan-2-one;hydrochloride |
| SMILES | COc1ccc2nc(SCC(C)=O)[nH]c2c1.Cl |
| InChI | InChI=1S/C11H12N2O2S.ClH/c1-7(14)6-16-11-12-9-4-3-8(15-2)5-10(9)13-11;/h3-5H,6H2,1-2H3,(H,12,13);1H |
| InChIKey | OOQZOWUBSHOSOV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |