C15H19N3O2S — CID 950856
N-cyclopentyl-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 950856) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-cyclopentyl-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 950856 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-cyclopentyl-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccc2nc(SCC(=O)NC3CCCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-20-11-6-7-12-13(8-11)18-15(17-12)21-9-14(19)16-10-4-2-3-5-10/h6-8,10H,2-5,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | JNNWAXFDKAGKOV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |