C17H14F2N2O3S — CID 7246694
1-[4-(difluoromethoxy)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]ethanone (PubChem CID 7246694) has the molecular formula C17H14F2N2O3S and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 7246694 |
| Molecular Formula | C17H14F2N2O3S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]ethanone |
| SMILES | COc1ccc2nc(SCC(=O)c3ccc(OC(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C17H14F2N2O3S/c1-23-12-6-7-13-14(8-12)21-17(20-13)25-9-15(22)10-2-4-11(5-3-10)24-16(18)19/h2-8,16H,9H2,1H3,(H,20,21) |
| InChIKey | MMGHLWKYZXDXCW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |