C19H20N2O2S — CID 7225507
2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-1-(4-propylphenyl)ethanone (PubChem CID 7225507) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-1-(4-propylphenyl)ethanone.
| Compound Name | 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-1-(4-propylphenyl)ethanone |
|---|---|
| PubChem CID | 7225507 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-1-(4-propylphenyl)ethanone |
| SMILES | CCCc1ccc(C(=O)CSc2nc3ccc(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-3-4-13-5-7-14(8-6-13)18(22)12-24-19-20-16-10-9-15(23-2)11-17(16)21-19/h5-11H,3-4,12H2,1-2H3,(H,20,21) |
| InChIKey | RIKAMQJMRKRDQT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |